About N-butyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide
N-butyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide (PubChem CID 167241764) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is N-butyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide.
Molecular Properties
| Compound Name | N-butyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide |
| PubChem CID | 167241764 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | N-butyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide |
| SMILES | CCCCNC(=O)C(C)C1C=CC(C)O1 |
| InChI | InChI=1S/C12H21NO2/c1-4-5-8-13-12(14)10(3)11-7-6-9(2)15-11/h6-7,9-11H,4-5,8H2,1-3H3,(H,13,14) |
| InChIKey | UZLIBEITAKLKHQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide?
The IUPAC name of N-butyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide (CID 167241764) is N-butyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide.
What is the SMILES notation for N-butyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide?
The canonical SMILES for N-butyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide is CCCCNC(=O)C(C)C1C=CC(C)O1.
What is the InChIKey of N-butyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide?
The InChIKey is UZLIBEITAKLKHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO2/c1-4-5-8-13-12(14)10(3)11-7-6-9(2)15-11/h6-7,9-11H,4-5,8H2,1-3H3,(H,13,14).
What are the key properties of N-butyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide?
N-butyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide has a molecular weight of 211.30 g/mol, XLogP of 1.88, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-(5-methyl-2,5-dihydrofuran-2-yl)propanamide is sourced from PubChem (CID 167241764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).