C14H25NO — CID 167242092
(2E,4Z,6E)-5-ethyl-2-methoxy-N-methyldeca-2,4,6-trien-4-amine (PubChem CID 167242092) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (2E,4Z,6E)-5-ethyl-2-methoxy-N-methyldeca-2,4,6-trien-4-amine.
| Compound Name | (2E,4Z,6E)-5-ethyl-2-methoxy-N-methyldeca-2,4,6-trien-4-amine |
|---|---|
| PubChem CID | 167242092 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (2E,4Z,6E)-5-ethyl-2-methoxy-N-methyldeca-2,4,6-trien-4-amine |
| SMILES | CCC/C=C/C(CC)=C(/C=C(\C)OC)NC |
| InChI | InChI=1S/C14H25NO/c1-6-8-9-10-13(7-2)14(15-4)11-12(3)16-5/h9-11,15H,6-8H2,1-5H3/b10-9+,12-11+,14-13- |
| InChIKey | RHOGZLWCUMAPLL-ANWBFWSBSA-N |
| XLogP | 3.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|