About 4-N-ethylpyrimidine-2,4,5-triamine
4-N-ethylpyrimidine-2,4,5-triamine (PubChem CID 167243214) has the molecular formula C6H11N5
and a molecular weight of 153.19 g/mol. Its IUPAC name is 4-N-ethylpyrimidine-2,4,5-triamine.
Molecular Properties
| Compound Name | 4-N-ethylpyrimidine-2,4,5-triamine |
| PubChem CID | 167243214 |
| Molecular Formula | C6H11N5 |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 4-N-ethylpyrimidine-2,4,5-triamine |
| SMILES | CCNc1nc(N)ncc1N |
| InChI | InChI=1S/C6H11N5/c1-2-9-5-4(7)3-10-6(8)11-5/h3H,2,7H2,1H3,(H3,8,9,10,11) |
| InChIKey | LSIZEUXIDVPZAO-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N-ethylpyrimidine-2,4,5-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-ethylpyrimidine-2,4,5-triamine?
The IUPAC name of 4-N-ethylpyrimidine-2,4,5-triamine (CID 167243214) is 4-N-ethylpyrimidine-2,4,5-triamine.
What is the SMILES notation for 4-N-ethylpyrimidine-2,4,5-triamine?
The canonical SMILES for 4-N-ethylpyrimidine-2,4,5-triamine is CCNc1nc(N)ncc1N.
What is the InChIKey of 4-N-ethylpyrimidine-2,4,5-triamine?
The InChIKey is LSIZEUXIDVPZAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N5/c1-2-9-5-4(7)3-10-6(8)11-5/h3H,2,7H2,1H3,(H3,8,9,10,11).
What are the key properties of 4-N-ethylpyrimidine-2,4,5-triamine?
4-N-ethylpyrimidine-2,4,5-triamine has a molecular weight of 153.19 g/mol, XLogP of 0.07, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-ethylpyrimidine-2,4,5-triamine is sourced from PubChem (CID 167243214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).