C20H27NO4 — CID 16724351
tert-butyl 4-[(2S)-1,4-dioxo-4-phenylbutan-2-yl]piperidine-1-carboxylate (PubChem CID 16724351) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is tert-butyl 4-[(2S)-1,4-dioxo-4-phenylbutan-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2S)-1,4-dioxo-4-phenylbutan-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 16724351 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | tert-butyl 4-[(2S)-1,4-dioxo-4-phenylbutan-2-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC([C@@H](C=O)CC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H27NO4/c1-20(2,3)25-19(24)21-11-9-15(10-12-21)17(14-22)13-18(23)16-7-5-4-6-8-16/h4-8,14-15,17H,9-13H2,1-3H3/t17-/m1/s1 |
| InChIKey | UYPUIZNORVWDSS-QGZVFWFLSA-N |
| XLogP | 3.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|