C23H28N8O — CID 167243607
4-N-cyclohexyl-2-N-[2-ethoxy-4-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 167243607) has the molecular formula C23H28N8O and a molecular weight of 432.53 g/mol. Its IUPAC name is 4-N-cyclohexyl-2-N-[2-ethoxy-4-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 4-N-cyclohexyl-2-N-[2-ethoxy-4-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 167243607 |
| Molecular Formula | C23H28N8O |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 4-N-cyclohexyl-2-N-[2-ethoxy-4-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | CCOc1cc(-c2nncn2C)ccc1Nc1nc(NC2CCCCC2)c2cccn2n1 |
| InChI | InChI=1S/C23H28N8O/c1-3-32-20-14-16(22-28-24-15-30(22)2)11-12-18(20)26-23-27-21(19-10-7-13-31(19)29-23)25-17-8-5-4-6-9-17/h7,10-15,17H,3-6,8-9H2,1-2H3,(H2,25,26,27,29) |
| InChIKey | UYFQPBUUBCABJI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |