C24H30N8O2 — CID 167243611
4-[[2-[2-ethoxy-4-(4-methyl-1,2,4-triazol-3-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-1-methylcyclohexan-1-ol (PubChem CID 167243611) has the molecular formula C24H30N8O2 and a molecular weight of 462.56 g/mol. Its IUPAC name is 4-[[2-[2-ethoxy-4-(4-methyl-1,2,4-triazol-3-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[[2-[2-ethoxy-4-(4-methyl-1,2,4-triazol-3-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 167243611 |
| Molecular Formula | C24H30N8O2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 4-[[2-[2-ethoxy-4-(4-methyl-1,2,4-triazol-3-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-1-methylcyclohexan-1-ol |
| SMILES | CCOc1cc(-c2nncn2C)ccc1Nc1nc(NC2CCC(C)(O)CC2)c2cccn2n1 |
| InChI | InChI=1S/C24H30N8O2/c1-4-34-20-14-16(22-29-25-15-31(22)3)7-8-18(20)27-23-28-21(19-6-5-13-32(19)30-23)26-17-9-11-24(2,33)12-10-17/h5-8,13-15,17,33H,4,9-12H2,1-3H3,(H2,26,27,28,30) |
| InChIKey | BDXPBOZKBLGXOP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |