C20H31N5O6 — CID 167244194
2-[[(2E)-2-[(Z)-but-2-en-2-yl]oxyiminoacetyl]amino]-3-methyl-N-[2-oxo-2-[[1-oxo-3-(2-oxopyrrolidin-3-yl)propan-2-yl]amino]ethyl]butanamide (PubChem CID 167244194) has the molecular formula C20H31N5O6 and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-[[(2E)-2-[(Z)-but-2-en-2-yl]oxyiminoacetyl]amino]-3-methyl-N-[2-oxo-2-[[1-oxo-3-(2-oxopyrrolidin-3-yl)propan-2-yl]amino]ethyl]butanamide.
| Compound Name | 2-[[(2E)-2-[(Z)-but-2-en-2-yl]oxyiminoacetyl]amino]-3-methyl-N-[2-oxo-2-[[1-oxo-3-(2-oxopyrrolidin-3-yl)propan-2-yl]amino]ethyl]butanamide |
|---|---|
| PubChem CID | 167244194 |
| Molecular Formula | C20H31N5O6 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 2-[[(2E)-2-[(Z)-but-2-en-2-yl]oxyiminoacetyl]amino]-3-methyl-N-[2-oxo-2-[[1-oxo-3-(2-oxopyrrolidin-3-yl)propan-2-yl]amino]ethyl]butanamide |
| SMILES | C/C=C(/C)O/N=C/C(=O)NC(C(=O)NCC(=O)NC(C=O)CC1CCNC1=O)C(C)C |
| InChI | InChI=1S/C20H31N5O6/c1-5-13(4)31-23-10-17(28)25-18(12(2)3)20(30)22-9-16(27)24-15(11-26)8-14-6-7-21-19(14)29/h5,10-12,14-15,18H,6-9H2,1-4H3,(H,21,29)(H,22,30)(H,24,27)(H,25,28)/b13-5-,23-10+ |
| InChIKey | DNOXPTPIIUTQDF-KNMOTLQESA-N |
| XLogP | -0.62 |
| TPSA | 155.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|