C24H30N8O2 — CID 167244259
2-N-[2-ethoxy-4-(4-methyl-1,2,4-triazol-3-yl)phenyl]-4-N-(4-methoxycyclohexyl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 167244259) has the molecular formula C24H30N8O2 and a molecular weight of 462.56 g/mol. Its IUPAC name is 2-N-[2-ethoxy-4-(4-methyl-1,2,4-triazol-3-yl)phenyl]-4-N-(4-methoxycyclohexyl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 2-N-[2-ethoxy-4-(4-methyl-1,2,4-triazol-3-yl)phenyl]-4-N-(4-methoxycyclohexyl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 167244259 |
| Molecular Formula | C24H30N8O2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 2-N-[2-ethoxy-4-(4-methyl-1,2,4-triazol-3-yl)phenyl]-4-N-(4-methoxycyclohexyl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | CCOc1cc(-c2nncn2C)ccc1Nc1nc(NC2CCC(OC)CC2)c2cccn2n1 |
| InChI | InChI=1S/C24H30N8O2/c1-4-34-21-14-16(23-29-25-15-31(23)2)7-12-19(21)27-24-28-22(20-6-5-13-32(20)30-24)26-17-8-10-18(33-3)11-9-17/h5-7,12-15,17-18H,4,8-11H2,1-3H3,(H2,26,27,28,30) |
| InChIKey | RDCIBHLOXJFNPE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |