About N-[2-[[(Z)-4-fluorobut-2-enylidene]amino]ethyl]-N'-methylethanimidamide
N-[2-[[(Z)-4-fluorobut-2-enylidene]amino]ethyl]-N'-methylethanimidamide (PubChem CID 167244290) has the molecular formula C9H16FN3
and a molecular weight of 185.25 g/mol. Its IUPAC name is N-[2-[[(Z)-4-fluorobut-2-enylidene]amino]ethyl]-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-[2-[[(Z)-4-fluorobut-2-enylidene]amino]ethyl]-N'-methylethanimidamide |
| PubChem CID | 167244290 |
| Molecular Formula | C9H16FN3 |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.13 |
| IUPAC Name | N-[2-[[(Z)-4-fluorobut-2-enylidene]amino]ethyl]-N'-methylethanimidamide |
| SMILES | C/N=C(\C)NCC/N=C/C=C\CF |
| InChI | InChI=1S/C9H16FN3/c1-9(11-2)13-8-7-12-6-4-3-5-10/h3-4,6H,5,7-8H2,1-2H3,(H,11,13)/b4-3-,12-6+ |
| InChIKey | PNCZLTJHCRVQLF-PRIXUFLXSA-N |
| XLogP | 1.22 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[[(Z)-4-fluorobut-2-enylidene]amino]ethyl]-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[[(Z)-4-fluorobut-2-enylidene]amino]ethyl]-N'-methylethanimidamide?
The IUPAC name of N-[2-[[(Z)-4-fluorobut-2-enylidene]amino]ethyl]-N'-methylethanimidamide (CID 167244290) is N-[2-[[(Z)-4-fluorobut-2-enylidene]amino]ethyl]-N'-methylethanimidamide.
What is the SMILES notation for N-[2-[[(Z)-4-fluorobut-2-enylidene]amino]ethyl]-N'-methylethanimidamide?
The canonical SMILES for N-[2-[[(Z)-4-fluorobut-2-enylidene]amino]ethyl]-N'-methylethanimidamide is C/N=C(\C)NCC/N=C/C=C\CF.
What is the InChIKey of N-[2-[[(Z)-4-fluorobut-2-enylidene]amino]ethyl]-N'-methylethanimidamide?
The InChIKey is PNCZLTJHCRVQLF-PRIXUFLXSA-N. The full InChI is InChI=1S/C9H16FN3/c1-9(11-2)13-8-7-12-6-4-3-5-10/h3-4,6H,5,7-8H2,1-2H3,(H,11,13)/b4-3-,12-6+.
What are the key properties of N-[2-[[(Z)-4-fluorobut-2-enylidene]amino]ethyl]-N'-methylethanimidamide?
N-[2-[[(Z)-4-fluorobut-2-enylidene]amino]ethyl]-N'-methylethanimidamide has a molecular weight of 185.25 g/mol, XLogP of 1.22, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[[(Z)-4-fluorobut-2-enylidene]amino]ethyl]-N'-methylethanimidamide is sourced from PubChem (CID 167244290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).