About (3S)-N-propan-2-yl-3-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide
(3S)-N-propan-2-yl-3-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide (PubChem CID 167244327) has the molecular formula C10H17F3N2O
and a molecular weight of 238.25 g/mol. Its IUPAC name is (3S)-N-propan-2-yl-3-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | (3S)-N-propan-2-yl-3-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide |
| PubChem CID | 167244327 |
| Molecular Formula | C10H17F3N2O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | (3S)-N-propan-2-yl-3-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide |
| SMILES | CC(C)NC(=O)N1CC[C@@H](CC(F)(F)F)C1 |
| InChI | InChI=1S/C10H17F3N2O/c1-7(2)14-9(16)15-4-3-8(6-15)5-10(11,12)13/h7-8H,3-6H2,1-2H3,(H,14,16)/t8-/m0/s1 |
| InChIKey | IJVBJEXNOUYLMU-QMMMGPOBSA-N |
| XLogP | 2.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-N-propan-2-yl-3-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N-propan-2-yl-3-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide?
The IUPAC name of (3S)-N-propan-2-yl-3-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide (CID 167244327) is (3S)-N-propan-2-yl-3-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide.
What is the SMILES notation for (3S)-N-propan-2-yl-3-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide?
The canonical SMILES for (3S)-N-propan-2-yl-3-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide is CC(C)NC(=O)N1CC[C@@H](CC(F)(F)F)C1.
What is the InChIKey of (3S)-N-propan-2-yl-3-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide?
The InChIKey is IJVBJEXNOUYLMU-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H17F3N2O/c1-7(2)14-9(16)15-4-3-8(6-15)5-10(11,12)13/h7-8H,3-6H2,1-2H3,(H,14,16)/t8-/m0/s1.
What are the key properties of (3S)-N-propan-2-yl-3-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide?
(3S)-N-propan-2-yl-3-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide has a molecular weight of 238.25 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N-propan-2-yl-3-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide is sourced from PubChem (CID 167244327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).