C16H27N3 — CID 167244658
(1Z,4Z)-7-ethenylimino-N,5-dimethyl-1-(methylideneamino)-N-propylocta-1,4-dien-1-amine (PubChem CID 167244658) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is (1Z,4Z)-7-ethenylimino-N,5-dimethyl-1-(methylideneamino)-N-propylocta-1,4-dien-1-amine.
| Compound Name | (1Z,4Z)-7-ethenylimino-N,5-dimethyl-1-(methylideneamino)-N-propylocta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 167244658 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | (1Z,4Z)-7-ethenylimino-N,5-dimethyl-1-(methylideneamino)-N-propylocta-1,4-dien-1-amine |
| SMILES | C=C/N=C(\C)C/C(C)=C\C/C=C(\N=C)N(C)CCC |
| InChI | InChI=1S/C16H27N3/c1-7-12-19(6)16(17-5)11-9-10-14(3)13-15(4)18-8-2/h8,10-11H,2,5,7,9,12-13H2,1,3-4,6H3/b14-10-,16-11+,18-15+ |
| InChIKey | HNANAWCNKXROSU-LAQJMSQMSA-N |
| XLogP | 4.20 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|