C17H24FN — CID 167244767
2-(fluoromethyl)-N-[(2Z,4E)-hexa-2,4-dien-2-yl]-N,3,4-trimethylcyclohepta-1,3,5-trien-1-amine (PubChem CID 167244767) has the molecular formula C17H24FN and a molecular weight of 261.38 g/mol. Its IUPAC name is 2-(fluoromethyl)-N-[(2Z,4E)-hexa-2,4-dien-2-yl]-N,3,4-trimethylcyclohepta-1,3,5-trien-1-amine.
| Compound Name | 2-(fluoromethyl)-N-[(2Z,4E)-hexa-2,4-dien-2-yl]-N,3,4-trimethylcyclohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 167244767 |
| Molecular Formula | C17H24FN |
| Molecular Weight | 261.38 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | 2-(fluoromethyl)-N-[(2Z,4E)-hexa-2,4-dien-2-yl]-N,3,4-trimethylcyclohepta-1,3,5-trien-1-amine |
| SMILES | C/C=C/C=C(/C)N(C)C1=C(CF)C(C)=C(C)C=CC1 |
| InChI | InChI=1S/C17H24FN/c1-6-7-10-14(3)19(5)17-11-8-9-13(2)15(4)16(17)12-18/h6-10H,11-12H2,1-5H3/b7-6+,14-10- |
| InChIKey | HPHRNDLFYJDGIU-FKEISFMISA-N |
| XLogP | 4.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|