About 2-chloro-5-methyl-3-propyl-1,3,2-oxazaphospholidine
2-chloro-5-methyl-3-propyl-1,3,2-oxazaphospholidine (PubChem CID 167244902) has the molecular formula C6H13ClNOP
and a molecular weight of 181.60 g/mol. Its IUPAC name is 2-chloro-5-methyl-3-propyl-1,3,2-oxazaphospholidine.
Molecular Properties
| Compound Name | 2-chloro-5-methyl-3-propyl-1,3,2-oxazaphospholidine |
| PubChem CID | 167244902 |
| Molecular Formula | C6H13ClNOP |
| Molecular Weight | 181.60 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 2-chloro-5-methyl-3-propyl-1,3,2-oxazaphospholidine |
| SMILES | CCCN1CC(C)OP1Cl |
| InChI | InChI=1S/C6H13ClNOP/c1-3-4-8-5-6(2)9-10(8)7/h6H,3-5H2,1-2H3 |
| InChIKey | JUJVFWIFDOHETO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.60 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-methyl-3-propyl-1,3,2-oxazaphospholidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-methyl-3-propyl-1,3,2-oxazaphospholidine?
The IUPAC name of 2-chloro-5-methyl-3-propyl-1,3,2-oxazaphospholidine (CID 167244902) is 2-chloro-5-methyl-3-propyl-1,3,2-oxazaphospholidine.
What is the SMILES notation for 2-chloro-5-methyl-3-propyl-1,3,2-oxazaphospholidine?
The canonical SMILES for 2-chloro-5-methyl-3-propyl-1,3,2-oxazaphospholidine is CCCN1CC(C)OP1Cl.
What is the InChIKey of 2-chloro-5-methyl-3-propyl-1,3,2-oxazaphospholidine?
The InChIKey is JUJVFWIFDOHETO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13ClNOP/c1-3-4-8-5-6(2)9-10(8)7/h6H,3-5H2,1-2H3.
What are the key properties of 2-chloro-5-methyl-3-propyl-1,3,2-oxazaphospholidine?
2-chloro-5-methyl-3-propyl-1,3,2-oxazaphospholidine has a molecular weight of 181.60 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-methyl-3-propyl-1,3,2-oxazaphospholidine is sourced from PubChem (CID 167244902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).