C24H26F5N7O3 — CID 167245836
N-[[2-[(S)-[[(2E)-2-cyano-2-hydroxyiminoacetyl]amino]-(4,4-difluorocyclohexyl)methyl]imidazo[1,2-b]pyridazin-7-yl]-cyclopropylmethyl]-4,4,4-trifluorobutanamide (PubChem CID 167245836) has the molecular formula C24H26F5N7O3 and a molecular weight of 555.51 g/mol. Its IUPAC name is N-[[2-[(S)-[[(2E)-2-cyano-2-hydroxyiminoacetyl]amino]-(4,4-difluorocyclohexyl)methyl]imidazo[1,2-b]pyridazin-7-yl]-cyclopropylmethyl]-4,4,4-trifluorobutanamide.
| Compound Name | N-[[2-[(S)-[[(2E)-2-cyano-2-hydroxyiminoacetyl]amino]-(4,4-difluorocyclohexyl)methyl]imidazo[1,2-b]pyridazin-7-yl]-cyclopropylmethyl]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 167245836 |
| Molecular Formula | C24H26F5N7O3 |
| Molecular Weight | 555.51 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | N-[[2-[(S)-[[(2E)-2-cyano-2-hydroxyiminoacetyl]amino]-(4,4-difluorocyclohexyl)methyl]imidazo[1,2-b]pyridazin-7-yl]-cyclopropylmethyl]-4,4,4-trifluorobutanamide |
| SMILES | N#C/C(=N\O)C(=O)N[C@H](c1cn2ncc(C(NC(=O)CCC(F)(F)F)C3CC3)cc2n1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C24H26F5N7O3/c25-23(26)6-3-14(4-7-23)21(34-22(38)16(10-30)35-39)17-12-36-18(32-17)9-15(11-31-36)20(13-1-2-13)33-19(37)5-8-24(27,28)29/h9,11-14,20-21,39H,1-8H2,(H,33,37)(H,34,38)/b35-16+/t20?,21-/m0/s1 |
| InChIKey | SAWMFLDUBHRVBZ-CTVOGRSLSA-N |
| XLogP | 3.98 |
| TPSA | 144.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|