C18H20N2OS — CID 167246079
4-(2-aminoethyl)-2-(furan-2-yl)-N-(2-thiophen-3-ylethyl)aniline (PubChem CID 167246079) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is 4-(2-aminoethyl)-2-(furan-2-yl)-N-(2-thiophen-3-ylethyl)aniline.
| Compound Name | 4-(2-aminoethyl)-2-(furan-2-yl)-N-(2-thiophen-3-ylethyl)aniline |
|---|---|
| PubChem CID | 167246079 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 4-(2-aminoethyl)-2-(furan-2-yl)-N-(2-thiophen-3-ylethyl)aniline |
| SMILES | NCCc1ccc(NCCc2ccsc2)c(-c2ccco2)c1 |
| InChI | InChI=1S/C18H20N2OS/c19-8-5-14-3-4-17(16(12-14)18-2-1-10-21-18)20-9-6-15-7-11-22-13-15/h1-4,7,10-13,20H,5-6,8-9,19H2 |
| InChIKey | FRCXDVOYNVLBMX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |