C27H36F5N5O3 — CID 167246241
tert-butyl N-[(1S)-1-[7-[cyclopropyl-[[2-(3,3-difluorocyclobutyl)acetyl]amino]methyl]imidazo[1,2-b]pyridazin-2-yl]-4,4,4-trifluoro-3,3-dimethylbutyl]carbamate (PubChem CID 167246241) has the molecular formula C27H36F5N5O3 and a molecular weight of 573.61 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[7-[cyclopropyl-[[2-(3,3-difluorocyclobutyl)acetyl]amino]methyl]imidazo[1,2-b]pyridazin-2-yl]-4,4,4-trifluoro-3,3-dimethylbutyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[7-[cyclopropyl-[[2-(3,3-difluorocyclobutyl)acetyl]amino]methyl]imidazo[1,2-b]pyridazin-2-yl]-4,4,4-trifluoro-3,3-dimethylbutyl]carbamate |
|---|---|
| PubChem CID | 167246241 |
| Molecular Formula | C27H36F5N5O3 |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | tert-butyl N-[(1S)-1-[7-[cyclopropyl-[[2-(3,3-difluorocyclobutyl)acetyl]amino]methyl]imidazo[1,2-b]pyridazin-2-yl]-4,4,4-trifluoro-3,3-dimethylbutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(C)(C)C(F)(F)F)c1cn2ncc(C(NC(=O)CC3CC(F)(F)C3)C3CC3)cc2n1 |
| InChI | InChI=1S/C27H36F5N5O3/c1-24(2,3)40-23(39)35-18(12-25(4,5)27(30,31)32)19-14-37-20(34-19)9-17(13-33-37)22(16-6-7-16)36-21(38)8-15-10-26(28,29)11-15/h9,13-16,18,22H,6-8,10-12H2,1-5H3,(H,35,39)(H,36,38)/t18-,22?/m0/s1 |
| InChIKey | YAPNPFDEQYUYPH-HXBUSHRASA-N |
| XLogP | 6.28 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |