C9H11F4N3 — CID 167246262
4-ethyl-1-[(2,2,3,3-tetrafluorocyclobutyl)methyl]triazole (PubChem CID 167246262) has the molecular formula C9H11F4N3 and a molecular weight of 237.20 g/mol. Its IUPAC name is 4-ethyl-1-[(2,2,3,3-tetrafluorocyclobutyl)methyl]triazole.
| Compound Name | 4-ethyl-1-[(2,2,3,3-tetrafluorocyclobutyl)methyl]triazole |
|---|---|
| PubChem CID | 167246262 |
| Molecular Formula | C9H11F4N3 |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 4-ethyl-1-[(2,2,3,3-tetrafluorocyclobutyl)methyl]triazole |
| SMILES | CCc1cn(CC2CC(F)(F)C2(F)F)nn1 |
| InChI | InChI=1S/C9H11F4N3/c1-2-7-5-16(15-14-7)4-6-3-8(10,11)9(6,12)13/h5-6H,2-4H2,1H3 |
| InChIKey | BSEOLJSVGYBXAW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|