About O-(1,1-dioxothian-4-yl) methylsulfanylmethanethioate
O-(1,1-dioxothian-4-yl) methylsulfanylmethanethioate (PubChem CID 167246370) has the molecular formula C7H12O3S3
and a molecular weight of 240.37 g/mol. Its IUPAC name is O-(1,1-dioxothian-4-yl) methylsulfanylmethanethioate.
Molecular Properties
| Compound Name | O-(1,1-dioxothian-4-yl) methylsulfanylmethanethioate |
| PubChem CID | 167246370 |
| Molecular Formula | C7H12O3S3 |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | O-(1,1-dioxothian-4-yl) methylsulfanylmethanethioate |
| SMILES | CSC(=S)OC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C7H12O3S3/c1-12-7(11)10-6-2-4-13(8,9)5-3-6/h6H,2-5H2,1H3 |
| InChIKey | IWZXTAOOZFVSCM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(1,1-dioxothian-4-yl) methylsulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(1,1-dioxothian-4-yl) methylsulfanylmethanethioate?
The IUPAC name of O-(1,1-dioxothian-4-yl) methylsulfanylmethanethioate (CID 167246370) is O-(1,1-dioxothian-4-yl) methylsulfanylmethanethioate.
What is the SMILES notation for O-(1,1-dioxothian-4-yl) methylsulfanylmethanethioate?
The canonical SMILES for O-(1,1-dioxothian-4-yl) methylsulfanylmethanethioate is CSC(=S)OC1CCS(=O)(=O)CC1.
What is the InChIKey of O-(1,1-dioxothian-4-yl) methylsulfanylmethanethioate?
The InChIKey is IWZXTAOOZFVSCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3S3/c1-12-7(11)10-6-2-4-13(8,9)5-3-6/h6H,2-5H2,1H3.
What are the key properties of O-(1,1-dioxothian-4-yl) methylsulfanylmethanethioate?
O-(1,1-dioxothian-4-yl) methylsulfanylmethanethioate has a molecular weight of 240.37 g/mol, XLogP of 1.23, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-(1,1-dioxothian-4-yl) methylsulfanylmethanethioate is sourced from PubChem (CID 167246370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).