C18H28O5 — CID 16724638
(1R,7S,11E,13S,15S)-15-(methoxymethoxy)-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-ene-2,5-dione (PubChem CID 16724638) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is (1R,7S,11E,13S,15S)-15-(methoxymethoxy)-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-ene-2,5-dione.
| Compound Name | (1R,7S,11E,13S,15S)-15-(methoxymethoxy)-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-ene-2,5-dione |
|---|---|
| PubChem CID | 16724638 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (1R,7S,11E,13S,15S)-15-(methoxymethoxy)-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-ene-2,5-dione |
| SMILES | COCO[C@H]1C[C@H]2/C=C/CCC[C@H](C)OC(=O)CCC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C18H28O5/c1-13-6-4-3-5-7-14-10-15(22-12-21-2)11-16(14)17(19)8-9-18(20)23-13/h5,7,13-16H,3-4,6,8-12H2,1-2H3/b7-5+/t13-,14+,15-,16+/m0/s1 |
| InChIKey | KETAIZJFOLNGFG-ZCGUEBEASA-N |
| XLogP | 3.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|