C17H26O5 — CID 16724679
(1R,6S,10Z,12S,14S)-14-(methoxymethoxy)-6-methyl-5-oxabicyclo[10.3.0]pentadec-10-ene-2,4-dione (PubChem CID 16724679) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is (1R,6S,10Z,12S,14S)-14-(methoxymethoxy)-6-methyl-5-oxabicyclo[10.3.0]pentadec-10-ene-2,4-dione.
| Compound Name | (1R,6S,10Z,12S,14S)-14-(methoxymethoxy)-6-methyl-5-oxabicyclo[10.3.0]pentadec-10-ene-2,4-dione |
|---|---|
| PubChem CID | 16724679 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (1R,6S,10Z,12S,14S)-14-(methoxymethoxy)-6-methyl-5-oxabicyclo[10.3.0]pentadec-10-ene-2,4-dione |
| SMILES | COCO[C@H]1C[C@H]2/C=C\CCC[C@H](C)OC(=O)CC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C17H26O5/c1-12-6-4-3-5-7-13-8-14(21-11-20-2)9-15(13)16(18)10-17(19)22-12/h5,7,12-15H,3-4,6,8-11H2,1-2H3/b7-5-/t12-,13+,14-,15+/m0/s1 |
| InChIKey | RKLLDEFMVRCYIY-LIKDXXBLSA-N |
| XLogP | 2.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|