C26H28N2O — CID 16724786
(3R,4R)-3-benzyl-4-[benzyl-[(1S)-1-phenylethyl]amino]pyrrolidin-2-one (PubChem CID 16724786) has the molecular formula C26H28N2O and a molecular weight of 384.52 g/mol. Its IUPAC name is (3R,4R)-3-benzyl-4-[benzyl-[(1S)-1-phenylethyl]amino]pyrrolidin-2-one.
| Compound Name | (3R,4R)-3-benzyl-4-[benzyl-[(1S)-1-phenylethyl]amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 16724786 |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (3R,4R)-3-benzyl-4-[benzyl-[(1S)-1-phenylethyl]amino]pyrrolidin-2-one |
| SMILES | C[C@@H](c1ccccc1)N(Cc1ccccc1)[C@H]1CNC(=O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C26H28N2O/c1-20(23-15-9-4-10-16-23)28(19-22-13-7-3-8-14-22)25-18-27-26(29)24(25)17-21-11-5-2-6-12-21/h2-16,20,24-25H,17-19H2,1H3,(H,27,29)/t20-,24+,25-/m0/s1 |
| InChIKey | DQROERIHHNGAGO-AMDXRBSFSA-N |
| XLogP | 4.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |