C21H27NO5 — CID 16724818
(1S,2S,4R,6R,9S)-9-tert-butyl-2-methyl-7-oxo-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carbaldehyde (PubChem CID 16724818) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is (1S,2S,4R,6R,9S)-9-tert-butyl-2-methyl-7-oxo-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carbaldehyde.
| Compound Name | (1S,2S,4R,6R,9S)-9-tert-butyl-2-methyl-7-oxo-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carbaldehyde |
|---|---|
| PubChem CID | 16724818 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (1S,2S,4R,6R,9S)-9-tert-butyl-2-methyl-7-oxo-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carbaldehyde |
| SMILES | CC(C)(C)[C@@H]1OC[C@]2(C=O)N1C(=O)[C@@H]1C[C@H](OCc3ccccc3)O[C@@]12C |
| InChI | InChI=1S/C21H27NO5/c1-19(2,3)18-22-17(24)15-10-16(25-11-14-8-6-5-7-9-14)27-20(15,4)21(22,12-23)13-26-18/h5-9,12,15-16,18H,10-11,13H2,1-4H3/t15-,16+,18-,20-,21-/m0/s1 |
| InChIKey | CQNONFJTLPCXMG-OKSLILNBSA-N |
| XLogP | 2.51 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|