C14H11N7O6S2 — CID 167248209
4,6-bis(2-methylsulfonylpyrimidin-4-yl)-1,3,5-triazine-2-carboxylic acid (PubChem CID 167248209) has the molecular formula C14H11N7O6S2 and a molecular weight of 437.42 g/mol. Its IUPAC name is 4,6-bis(2-methylsulfonylpyrimidin-4-yl)-1,3,5-triazine-2-carboxylic acid.
| Compound Name | 4,6-bis(2-methylsulfonylpyrimidin-4-yl)-1,3,5-triazine-2-carboxylic acid |
|---|---|
| PubChem CID | 167248209 |
| Molecular Formula | C14H11N7O6S2 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | 4,6-bis(2-methylsulfonylpyrimidin-4-yl)-1,3,5-triazine-2-carboxylic acid |
| SMILES | CS(=O)(=O)c1nccc(-c2nc(C(=O)O)nc(-c3ccnc(S(C)(=O)=O)n3)n2)n1 |
| InChI | InChI=1S/C14H11N7O6S2/c1-28(24,25)13-15-5-3-7(17-13)9-19-10(21-11(20-9)12(22)23)8-4-6-16-14(18-8)29(2,26)27/h3-6H,1-2H3,(H,22,23) |
| InChIKey | GOLYRZCTOGBZCK-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 195.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |