C26H33NO11S2 — CID 16724929
methyl (2R,4S,5R,6R)-4-acetyloxy-5-(ethanethioylamino)-2-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 16724929) has the molecular formula C26H33NO11S2 and a molecular weight of 599.68 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-4-acetyloxy-5-(ethanethioylamino)-2-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-4-acetyloxy-5-(ethanethioylamino)-2-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 16724929 |
| Molecular Formula | C26H33NO11S2 |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | methyl (2R,4S,5R,6R)-4-acetyloxy-5-(ethanethioylamino)-2-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(Sc2ccccc2)C[C@H](OC(C)=O)[C@@H](NC(C)=S)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C26H33NO11S2/c1-14(39)27-22-20(35-16(3)29)12-26(25(32)33-6,40-19-10-8-7-9-11-19)38-24(22)23(37-18(5)31)21(36-17(4)30)13-34-15(2)28/h7-11,20-24H,12-13H2,1-6H3,(H,27,39)/t20-,21+,22+,23+,24+,26+/m0/s1 |
| InChIKey | HAPXKUWGGYOOCB-RLKHCHHESA-N |
| XLogP | 2.10 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|