C27H37NO6 — CID 16724937
2-[(3S,6R,7S,7aR)-3-tert-butyl-7a-[(R)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-7-hydroxy-7-methyl-5-oxo-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-yl]ethyl benzoate (PubChem CID 16724937) has the molecular formula C27H37NO6 and a molecular weight of 471.59 g/mol. Its IUPAC name is 2-[(3S,6R,7S,7aR)-3-tert-butyl-7a-[(R)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-7-hydroxy-7-methyl-5-oxo-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-yl]ethyl benzoate.
| Compound Name | 2-[(3S,6R,7S,7aR)-3-tert-butyl-7a-[(R)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-7-hydroxy-7-methyl-5-oxo-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-yl]ethyl benzoate |
|---|---|
| PubChem CID | 16724937 |
| Molecular Formula | C27H37NO6 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 2-[(3S,6R,7S,7aR)-3-tert-butyl-7a-[(R)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-7-hydroxy-7-methyl-5-oxo-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-yl]ethyl benzoate |
| SMILES | CC(C)(C)[C@@H]1OC[C@]2([C@H](O)[C@@H]3C=CCCC3)N1C(=O)[C@H](CCOC(=O)c1ccccc1)[C@]2(C)O |
| InChI | InChI=1S/C27H37NO6/c1-25(2,3)24-28-22(30)20(15-16-33-23(31)19-13-9-6-10-14-19)26(4,32)27(28,17-34-24)21(29)18-11-7-5-8-12-18/h6-7,9-11,13-14,18,20-21,24,29,32H,5,8,12,15-17H2,1-4H3/t18-,20+,21-,24+,26+,27-/m1/s1 |
| InChIKey | LVQDHLYSBKELTG-OVJQVNGJSA-N |
| XLogP | 3.30 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|