C16H27NS — CID 167249802
5-ethylsulfanyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]-N-methyl-4-methylidenehexan-1-amine (PubChem CID 167249802) has the molecular formula C16H27NS and a molecular weight of 265.47 g/mol. Its IUPAC name is 5-ethylsulfanyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]-N-methyl-4-methylidenehexan-1-amine.
| Compound Name | 5-ethylsulfanyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]-N-methyl-4-methylidenehexan-1-amine |
|---|---|
| PubChem CID | 167249802 |
| Molecular Formula | C16H27NS |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 5-ethylsulfanyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]-N-methyl-4-methylidenehexan-1-amine |
| SMILES | C=C/C=C\C(=C)N(C)CCCC(=C)C(C)SCC |
| InChI | InChI=1S/C16H27NS/c1-7-9-12-15(4)17(6)13-10-11-14(3)16(5)18-8-2/h7,9,12,16H,1,3-4,8,10-11,13H2,2,5-6H3/b12-9- |
| InChIKey | KJQLHLASPNRUTI-XFXZXTDPSA-N |
| XLogP | 4.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|