About 2-(2,5-dioxopyrrolidin-1-yl)ethyl butanoate
2-(2,5-dioxopyrrolidin-1-yl)ethyl butanoate (PubChem CID 167250254) has the molecular formula C10H15NO4
and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)ethyl butanoate.
Molecular Properties
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)ethyl butanoate |
| PubChem CID | 167250254 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)ethyl butanoate |
| SMILES | CCCC(=O)OCCN1C(=O)CCC1=O |
| InChI | InChI=1S/C10H15NO4/c1-2-3-10(14)15-7-6-11-8(12)4-5-9(11)13/h2-7H2,1H3 |
| InChIKey | CTNZSBLOMCRERV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxopyrrolidin-1-yl)ethyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxopyrrolidin-1-yl)ethyl butanoate?
The IUPAC name of 2-(2,5-dioxopyrrolidin-1-yl)ethyl butanoate (CID 167250254) is 2-(2,5-dioxopyrrolidin-1-yl)ethyl butanoate.
What is the SMILES notation for 2-(2,5-dioxopyrrolidin-1-yl)ethyl butanoate?
The canonical SMILES for 2-(2,5-dioxopyrrolidin-1-yl)ethyl butanoate is CCCC(=O)OCCN1C(=O)CCC1=O.
What is the InChIKey of 2-(2,5-dioxopyrrolidin-1-yl)ethyl butanoate?
The InChIKey is CTNZSBLOMCRERV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO4/c1-2-3-10(14)15-7-6-11-8(12)4-5-9(11)13/h2-7H2,1H3.
What are the key properties of 2-(2,5-dioxopyrrolidin-1-yl)ethyl butanoate?
2-(2,5-dioxopyrrolidin-1-yl)ethyl butanoate has a molecular weight of 213.23 g/mol, XLogP of 0.48, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxopyrrolidin-1-yl)ethyl butanoate is sourced from PubChem (CID 167250254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).