About 4-cyano-N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-methylpentanamide
4-cyano-N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-methylpentanamide (PubChem CID 167250256) has the molecular formula C13H19N3O3
and a molecular weight of 265.31 g/mol. Its IUPAC name is 4-cyano-N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-methylpentanamide.
Molecular Properties
| Compound Name | 4-cyano-N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-methylpentanamide |
| PubChem CID | 167250256 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 4-cyano-N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-methylpentanamide |
| SMILES | CC(C)(C#N)CCC(=O)NCCN1C(=O)CCC1=O |
| InChI | InChI=1S/C13H19N3O3/c1-13(2,9-14)6-5-10(17)15-7-8-16-11(18)3-4-12(16)19/h3-8H2,1-2H3,(H,15,17) |
| InChIKey | ODECMFIBBONYRL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-cyano-N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-methylpentanamide?
The IUPAC name of 4-cyano-N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-methylpentanamide (CID 167250256) is 4-cyano-N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-methylpentanamide.
What is the SMILES notation for 4-cyano-N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-methylpentanamide?
The canonical SMILES for 4-cyano-N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-methylpentanamide is CC(C)(C#N)CCC(=O)NCCN1C(=O)CCC1=O.
What is the InChIKey of 4-cyano-N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-methylpentanamide?
The InChIKey is ODECMFIBBONYRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O3/c1-13(2,9-14)6-5-10(17)15-7-8-16-11(18)3-4-12(16)19/h3-8H2,1-2H3,(H,15,17).
What are the key properties of 4-cyano-N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-methylpentanamide?
4-cyano-N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-methylpentanamide has a molecular weight of 265.31 g/mol, XLogP of 0.58, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-methylpentanamide is sourced from PubChem (CID 167250256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).