About (2S,3S)-2-ethyl-3-fluoro-2,4-dimethyloxane
(2S,3S)-2-ethyl-3-fluoro-2,4-dimethyloxane (PubChem CID 167250613) has the molecular formula C9H17FO
and a molecular weight of 160.23 g/mol. Its IUPAC name is (2S,3S)-2-ethyl-3-fluoro-2,4-dimethyloxane.
Molecular Properties
| Compound Name | (2S,3S)-2-ethyl-3-fluoro-2,4-dimethyloxane |
| PubChem CID | 167250613 |
| Molecular Formula | C9H17FO |
| Molecular Weight | 160.23 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | (2S,3S)-2-ethyl-3-fluoro-2,4-dimethyloxane |
| SMILES | CC[C@]1(C)OCCC(C)[C@@H]1F |
| InChI | InChI=1S/C9H17FO/c1-4-9(3)8(10)7(2)5-6-11-9/h7-8H,4-6H2,1-3H3/t7?,8-,9-/m0/s1 |
| InChIKey | RPNRTKYKSTWTPH-NPPUSCPJSA-N |
| XLogP | 2.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S,3S)-2-ethyl-3-fluoro-2,4-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2-ethyl-3-fluoro-2,4-dimethyloxane?
The IUPAC name of (2S,3S)-2-ethyl-3-fluoro-2,4-dimethyloxane (CID 167250613) is (2S,3S)-2-ethyl-3-fluoro-2,4-dimethyloxane.
What is the SMILES notation for (2S,3S)-2-ethyl-3-fluoro-2,4-dimethyloxane?
The canonical SMILES for (2S,3S)-2-ethyl-3-fluoro-2,4-dimethyloxane is CC[C@]1(C)OCCC(C)[C@@H]1F.
What is the InChIKey of (2S,3S)-2-ethyl-3-fluoro-2,4-dimethyloxane?
The InChIKey is RPNRTKYKSTWTPH-NPPUSCPJSA-N. The full InChI is InChI=1S/C9H17FO/c1-4-9(3)8(10)7(2)5-6-11-9/h7-8H,4-6H2,1-3H3/t7?,8-,9-/m0/s1.
What are the key properties of (2S,3S)-2-ethyl-3-fluoro-2,4-dimethyloxane?
(2S,3S)-2-ethyl-3-fluoro-2,4-dimethyloxane has a molecular weight of 160.23 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-ethyl-3-fluoro-2,4-dimethyloxane is sourced from PubChem (CID 167250613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).