C23H44O3Si — CID 16725115
[(4E,7S,8R,9E)-6-hydroxy-7-methyl-8-propan-2-yl-11-trimethylsilylundeca-4,9-dienyl] 2,2-dimethylpropanoate (PubChem CID 16725115) has the molecular formula C23H44O3Si and a molecular weight of 396.69 g/mol. Its IUPAC name is [(4E,7S,8R,9E)-6-hydroxy-7-methyl-8-propan-2-yl-11-trimethylsilylundeca-4,9-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(4E,7S,8R,9E)-6-hydroxy-7-methyl-8-propan-2-yl-11-trimethylsilylundeca-4,9-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 16725115 |
| Molecular Formula | C23H44O3Si |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | [(4E,7S,8R,9E)-6-hydroxy-7-methyl-8-propan-2-yl-11-trimethylsilylundeca-4,9-dienyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)[C@H](/C=C/C[Si](C)(C)C)[C@H](C)C(O)/C=C/CCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C23H44O3Si/c1-18(2)20(14-13-17-27(7,8)9)19(3)21(24)15-11-10-12-16-26-22(25)23(4,5)6/h11,13-15,18-21,24H,10,12,16-17H2,1-9H3/b14-13+,15-11+/t19-,20-,21?/m0/s1 |
| InChIKey | JEEBVHQCTHROGM-XEGJBPCJSA-N |
| XLogP | 6.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|