C30H36F4N6O3 — CID 167251193
1-[4-[7-[3-amino-2-fluoro-5-methyl-6-(trifluoromethyl)phenyl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 167251193) has the molecular formula C30H36F4N6O3 and a molecular weight of 604.65 g/mol. Its IUPAC name is 1-[4-[7-[3-amino-2-fluoro-5-methyl-6-(trifluoromethyl)phenyl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[7-[3-amino-2-fluoro-5-methyl-6-(trifluoromethyl)phenyl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167251193 |
| Molecular Formula | C30H36F4N6O3 |
| Molecular Weight | 604.65 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | 1-[4-[7-[3-amino-2-fluoro-5-methyl-6-(trifluoromethyl)phenyl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2nc(OCC34CCCN3CCC4)nc3c2COC(c2c(F)c(N)cc(C)c2C(F)(F)F)C3)CC1 |
| InChI | InChI=1S/C30H36F4N6O3/c1-3-23(41)38-10-12-39(13-11-38)27-19-16-42-22(24-25(30(32,33)34)18(2)14-20(35)26(24)31)15-21(19)36-28(37-27)43-17-29-6-4-8-40(29)9-5-7-29/h3,14,22H,1,4-13,15-17,35H2,2H3 |
| InChIKey | JWECHZQFYTWZHI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.65 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|