C20H30O2S — CID 16725122
S-tert-butyl (E,4S,5R)-3-hydroxy-4-methyl-5-phenylnon-6-enethioate (PubChem CID 16725122) has the molecular formula C20H30O2S and a molecular weight of 334.53 g/mol. Its IUPAC name is S-tert-butyl (E,4S,5R)-3-hydroxy-4-methyl-5-phenylnon-6-enethioate.
| Compound Name | S-tert-butyl (E,4S,5R)-3-hydroxy-4-methyl-5-phenylnon-6-enethioate |
|---|---|
| PubChem CID | 16725122 |
| Molecular Formula | C20H30O2S |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | S-tert-butyl (E,4S,5R)-3-hydroxy-4-methyl-5-phenylnon-6-enethioate |
| SMILES | CC/C=C/[C@@H](c1ccccc1)[C@H](C)C(O)CC(=O)SC(C)(C)C |
| InChI | InChI=1S/C20H30O2S/c1-6-7-13-17(16-11-9-8-10-12-16)15(2)18(21)14-19(22)23-20(3,4)5/h7-13,15,17-18,21H,6,14H2,1-5H3/b13-7+/t15-,17+,18?/m0/s1 |
| InChIKey | HOYRUMGOZHNEIA-LWLOSLDSSA-N |
| XLogP | 5.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|