C12H21N3O — CID 167251375
(1E,3E)-1-(methylideneamino)-1-(1-methylpiperidin-4-yl)oxypenta-1,3-dien-3-amine (PubChem CID 167251375) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is (1E,3E)-1-(methylideneamino)-1-(1-methylpiperidin-4-yl)oxypenta-1,3-dien-3-amine.
| Compound Name | (1E,3E)-1-(methylideneamino)-1-(1-methylpiperidin-4-yl)oxypenta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 167251375 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | (1E,3E)-1-(methylideneamino)-1-(1-methylpiperidin-4-yl)oxypenta-1,3-dien-3-amine |
| SMILES | C=N/C(=C\C(N)=C/C)OC1CCN(C)CC1 |
| InChI | InChI=1S/C12H21N3O/c1-4-10(13)9-12(14-2)16-11-5-7-15(3)8-6-11/h4,9,11H,2,5-8,13H2,1,3H3/b10-4+,12-9+ |
| InChIKey | HSTRPSGYEALGKH-XCTMZBPXSA-N |
| XLogP | 1.50 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|