C21H34O5Si — CID 16725138
(3S,4R)-4-[(2S,3S,4S)-5-[(4-methoxyphenyl)methoxy]-4-methyl-3-trimethylsilyloxypentan-2-yl]-3-methyloxetan-2-one (PubChem CID 16725138) has the molecular formula C21H34O5Si and a molecular weight of 394.58 g/mol. Its IUPAC name is (3S,4R)-4-[(2S,3S,4S)-5-[(4-methoxyphenyl)methoxy]-4-methyl-3-trimethylsilyloxypentan-2-yl]-3-methyloxetan-2-one.
| Compound Name | (3S,4R)-4-[(2S,3S,4S)-5-[(4-methoxyphenyl)methoxy]-4-methyl-3-trimethylsilyloxypentan-2-yl]-3-methyloxetan-2-one |
|---|---|
| PubChem CID | 16725138 |
| Molecular Formula | C21H34O5Si |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | (3S,4R)-4-[(2S,3S,4S)-5-[(4-methoxyphenyl)methoxy]-4-methyl-3-trimethylsilyloxypentan-2-yl]-3-methyloxetan-2-one |
| SMILES | COc1ccc(COC[C@H](C)[C@H](O[Si](C)(C)C)[C@@H](C)[C@H]2OC(=O)[C@H]2C)cc1 |
| InChI | InChI=1S/C21H34O5Si/c1-14(12-24-13-17-8-10-18(23-4)11-9-17)19(26-27(5,6)7)15(2)20-16(3)21(22)25-20/h8-11,14-16,19-20H,12-13H2,1-7H3/t14-,15+,16-,19-,20+/m0/s1 |
| InChIKey | FNZUOUVKWQCOFM-STNJDDFNSA-N |
| XLogP | 4.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|