C18H26O5 — CID 16725139
(3R,4R)-4-[(2R,3S,4S)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-4-methylpentan-2-yl]-3-methyloxetan-2-one (PubChem CID 16725139) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is (3R,4R)-4-[(2R,3S,4S)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-4-methylpentan-2-yl]-3-methyloxetan-2-one.
| Compound Name | (3R,4R)-4-[(2R,3S,4S)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-4-methylpentan-2-yl]-3-methyloxetan-2-one |
|---|---|
| PubChem CID | 16725139 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (3R,4R)-4-[(2R,3S,4S)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-4-methylpentan-2-yl]-3-methyloxetan-2-one |
| SMILES | COc1ccc(COC[C@H](C)[C@H](O)[C@@H](C)[C@H]2OC(=O)[C@@H]2C)cc1 |
| InChI | InChI=1S/C18H26O5/c1-11(16(19)12(2)17-13(3)18(20)23-17)9-22-10-14-5-7-15(21-4)8-6-14/h5-8,11-13,16-17,19H,9-10H2,1-4H3/t11-,12+,13+,16-,17+/m0/s1 |
| InChIKey | NLIXFCCXTXLYRN-KSWINOGPSA-N |
| XLogP | 2.41 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|