C28H36F4N6O2 — CID 167251624
2-fluoro-3-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(2S)-2-methylpiperazin-1-yl]-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-7-yl]-5-methyl-4-(trifluoromethyl)aniline (PubChem CID 167251624) has the molecular formula C28H36F4N6O2 and a molecular weight of 564.63 g/mol. Its IUPAC name is 2-fluoro-3-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(2S)-2-methylpiperazin-1-yl]-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-7-yl]-5-methyl-4-(trifluoromethyl)aniline.
| Compound Name | 2-fluoro-3-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(2S)-2-methylpiperazin-1-yl]-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-7-yl]-5-methyl-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 167251624 |
| Molecular Formula | C28H36F4N6O2 |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | 2-fluoro-3-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(2S)-2-methylpiperazin-1-yl]-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-7-yl]-5-methyl-4-(trifluoromethyl)aniline |
| SMILES | Cc1cc(N)c(F)c(C2Cc3nc(OCC45CCCN4CCC5)nc(N4CCNC[C@@H]4C)c3CO2)c1C(F)(F)F |
| InChI | InChI=1S/C28H36F4N6O2/c1-16-11-19(33)24(29)22(23(16)28(30,31)32)21-12-20-18(14-39-21)25(38-10-7-34-13-17(38)2)36-26(35-20)40-15-27-5-3-8-37(27)9-4-6-27/h11,17,21,34H,3-10,12-15,33H2,1-2H3/t17-,21?/m0/s1 |
| InChIKey | RLFSPXMNQBMJKS-PBVYKCSPSA-N |
| XLogP | 4.14 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|