C14H23N — CID 167251723
1,4-dimethyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3-propan-2-yl-2,3-dihydropyrrole (PubChem CID 167251723) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 1,4-dimethyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3-propan-2-yl-2,3-dihydropyrrole.
| Compound Name | 1,4-dimethyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3-propan-2-yl-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 167251723 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 1,4-dimethyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3-propan-2-yl-2,3-dihydropyrrole |
| SMILES | C/C=C\C=C/C1=C(C)C(C(C)C)CN1C |
| InChI | InChI=1S/C14H23N/c1-6-7-8-9-14-12(4)13(11(2)3)10-15(14)5/h6-9,11,13H,10H2,1-5H3/b7-6-,9-8- |
| InChIKey | HFGGZWHSYCERAJ-JPDBVBESSA-N |
| XLogP | 3.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|