About N-[(Z)-2-(3-ethyl-1,4-dimethyl-2,3-dihydropyrrol-5-yl)ethenyl]ethanimine
N-[(Z)-2-(3-ethyl-1,4-dimethyl-2,3-dihydropyrrol-5-yl)ethenyl]ethanimine (PubChem CID 167251762) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is N-[(Z)-2-(3-ethyl-1,4-dimethyl-2,3-dihydropyrrol-5-yl)ethenyl]ethanimine.
Molecular Properties
| Compound Name | N-[(Z)-2-(3-ethyl-1,4-dimethyl-2,3-dihydropyrrol-5-yl)ethenyl]ethanimine |
| PubChem CID | 167251762 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-[(Z)-2-(3-ethyl-1,4-dimethyl-2,3-dihydropyrrol-5-yl)ethenyl]ethanimine |
| SMILES | C/C=N/C=C\C1=C(C)C(CC)CN1C |
| InChI | InChI=1S/C12H20N2/c1-5-11-9-14(4)12(10(11)3)7-8-13-6-2/h6-8,11H,5,9H2,1-4H3/b8-7-,13-6+ |
| InChIKey | BYEYDLPHIQVJAQ-ZUKYEBQOSA-N |
| XLogP | 2.84 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-2-(3-ethyl-1,4-dimethyl-2,3-dihydropyrrol-5-yl)ethenyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-2-(3-ethyl-1,4-dimethyl-2,3-dihydropyrrol-5-yl)ethenyl]ethanimine?
The IUPAC name of N-[(Z)-2-(3-ethyl-1,4-dimethyl-2,3-dihydropyrrol-5-yl)ethenyl]ethanimine (CID 167251762) is N-[(Z)-2-(3-ethyl-1,4-dimethyl-2,3-dihydropyrrol-5-yl)ethenyl]ethanimine.
What is the SMILES notation for N-[(Z)-2-(3-ethyl-1,4-dimethyl-2,3-dihydropyrrol-5-yl)ethenyl]ethanimine?
The canonical SMILES for N-[(Z)-2-(3-ethyl-1,4-dimethyl-2,3-dihydropyrrol-5-yl)ethenyl]ethanimine is C/C=N/C=C\C1=C(C)C(CC)CN1C.
What is the InChIKey of N-[(Z)-2-(3-ethyl-1,4-dimethyl-2,3-dihydropyrrol-5-yl)ethenyl]ethanimine?
The InChIKey is BYEYDLPHIQVJAQ-ZUKYEBQOSA-N. The full InChI is InChI=1S/C12H20N2/c1-5-11-9-14(4)12(10(11)3)7-8-13-6-2/h6-8,11H,5,9H2,1-4H3/b8-7-,13-6+.
What are the key properties of N-[(Z)-2-(3-ethyl-1,4-dimethyl-2,3-dihydropyrrol-5-yl)ethenyl]ethanimine?
N-[(Z)-2-(3-ethyl-1,4-dimethyl-2,3-dihydropyrrol-5-yl)ethenyl]ethanimine has a molecular weight of 192.31 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-2-(3-ethyl-1,4-dimethyl-2,3-dihydropyrrol-5-yl)ethenyl]ethanimine is sourced from PubChem (CID 167251762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).