About 1-[[4-(3,4-dimethylphenoxy)-3-fluorophenyl]methyl]pyrimidine-2,4-dione
1-[[4-(3,4-dimethylphenoxy)-3-fluorophenyl]methyl]pyrimidine-2,4-dione (PubChem CID 167251822) has the molecular formula C19H17FN2O3
and a molecular weight of 340.35 g/mol. Its IUPAC name is 1-[[4-(3,4-dimethylphenoxy)-3-fluorophenyl]methyl]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[[4-(3,4-dimethylphenoxy)-3-fluorophenyl]methyl]pyrimidine-2,4-dione |
| PubChem CID | 167251822 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-[[4-(3,4-dimethylphenoxy)-3-fluorophenyl]methyl]pyrimidine-2,4-dione |
| SMILES | Cc1ccc(Oc2ccc(Cn3ccc(=O)[nH]c3=O)cc2F)cc1C |
| InChI | InChI=1S/C19H17FN2O3/c1-12-3-5-15(9-13(12)2)25-17-6-4-14(10-16(17)20)11-22-8-7-18(23)21-19(22)24/h3-10H,11H2,1-2H3,(H,21,23,24) |
| InChIKey | BCPGKLSSGZCZFN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[4-(3,4-dimethylphenoxy)-3-fluorophenyl]methyl]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(3,4-dimethylphenoxy)-3-fluorophenyl]methyl]pyrimidine-2,4-dione?
The IUPAC name of 1-[[4-(3,4-dimethylphenoxy)-3-fluorophenyl]methyl]pyrimidine-2,4-dione (CID 167251822) is 1-[[4-(3,4-dimethylphenoxy)-3-fluorophenyl]methyl]pyrimidine-2,4-dione.
What is the SMILES notation for 1-[[4-(3,4-dimethylphenoxy)-3-fluorophenyl]methyl]pyrimidine-2,4-dione?
The canonical SMILES for 1-[[4-(3,4-dimethylphenoxy)-3-fluorophenyl]methyl]pyrimidine-2,4-dione is Cc1ccc(Oc2ccc(Cn3ccc(=O)[nH]c3=O)cc2F)cc1C.
What is the InChIKey of 1-[[4-(3,4-dimethylphenoxy)-3-fluorophenyl]methyl]pyrimidine-2,4-dione?
The InChIKey is BCPGKLSSGZCZFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN2O3/c1-12-3-5-15(9-13(12)2)25-17-6-4-14(10-16(17)20)11-22-8-7-18(23)21-19(22)24/h3-10H,11H2,1-2H3,(H,21,23,24).
What are the key properties of 1-[[4-(3,4-dimethylphenoxy)-3-fluorophenyl]methyl]pyrimidine-2,4-dione?
1-[[4-(3,4-dimethylphenoxy)-3-fluorophenyl]methyl]pyrimidine-2,4-dione has a molecular weight of 340.35 g/mol, XLogP of 3.13, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(3,4-dimethylphenoxy)-3-fluorophenyl]methyl]pyrimidine-2,4-dione is sourced from PubChem (CID 167251822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).