C23H31N5O4S2 — CID 167252028
tert-butyl N-[4-[[2-[2-[2-(pent-4-ynoylamino)ethyl]-1,3-thiazol-4-yl]-1,3-thiazole-4-carbonyl]amino]butyl]carbamate (PubChem CID 167252028) has the molecular formula C23H31N5O4S2 and a molecular weight of 505.67 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-[2-[2-(pent-4-ynoylamino)ethyl]-1,3-thiazol-4-yl]-1,3-thiazole-4-carbonyl]amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-[2-[2-(pent-4-ynoylamino)ethyl]-1,3-thiazol-4-yl]-1,3-thiazole-4-carbonyl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 167252028 |
| Molecular Formula | C23H31N5O4S2 |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | tert-butyl N-[4-[[2-[2-[2-(pent-4-ynoylamino)ethyl]-1,3-thiazol-4-yl]-1,3-thiazole-4-carbonyl]amino]butyl]carbamate |
| SMILES | C#CCCC(=O)NCCc1nc(-c2nc(C(=O)NCCCCNC(=O)OC(C)(C)C)cs2)cs1 |
| InChI | InChI=1S/C23H31N5O4S2/c1-5-6-9-18(29)24-13-10-19-27-17(15-33-19)21-28-16(14-34-21)20(30)25-11-7-8-12-26-22(31)32-23(2,3)4/h1,14-15H,6-13H2,2-4H3,(H,24,29)(H,25,30)(H,26,31) |
| InChIKey | CKEZAUIFYAMEFT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|