About 1-[[3-chloro-4-(2,4-dimethylphenoxy)phenyl]methyl]-3-(difluoromethyl)pyrimidine-2,4-dione
1-[[3-chloro-4-(2,4-dimethylphenoxy)phenyl]methyl]-3-(difluoromethyl)pyrimidine-2,4-dione (PubChem CID 167252096) has the molecular formula C20H17ClF2N2O3
and a molecular weight of 406.82 g/mol. Its IUPAC name is 1-[[3-chloro-4-(2,4-dimethylphenoxy)phenyl]methyl]-3-(difluoromethyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[[3-chloro-4-(2,4-dimethylphenoxy)phenyl]methyl]-3-(difluoromethyl)pyrimidine-2,4-dione |
| PubChem CID | 167252096 |
| Molecular Formula | C20H17ClF2N2O3 |
| Molecular Weight | 406.82 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 1-[[3-chloro-4-(2,4-dimethylphenoxy)phenyl]methyl]-3-(difluoromethyl)pyrimidine-2,4-dione |
| SMILES | Cc1ccc(Oc2ccc(Cn3ccc(=O)n(C(F)F)c3=O)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C20H17ClF2N2O3/c1-12-3-5-16(13(2)9-12)28-17-6-4-14(10-15(17)21)11-24-8-7-18(26)25(19(22)23)20(24)27/h3-10,19H,11H2,1-2H3 |
| InChIKey | IKHOWEAMRPXBNV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.82 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[3-chloro-4-(2,4-dimethylphenoxy)phenyl]methyl]-3-(difluoromethyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3-chloro-4-(2,4-dimethylphenoxy)phenyl]methyl]-3-(difluoromethyl)pyrimidine-2,4-dione?
The IUPAC name of 1-[[3-chloro-4-(2,4-dimethylphenoxy)phenyl]methyl]-3-(difluoromethyl)pyrimidine-2,4-dione (CID 167252096) is 1-[[3-chloro-4-(2,4-dimethylphenoxy)phenyl]methyl]-3-(difluoromethyl)pyrimidine-2,4-dione.
What is the SMILES notation for 1-[[3-chloro-4-(2,4-dimethylphenoxy)phenyl]methyl]-3-(difluoromethyl)pyrimidine-2,4-dione?
The canonical SMILES for 1-[[3-chloro-4-(2,4-dimethylphenoxy)phenyl]methyl]-3-(difluoromethyl)pyrimidine-2,4-dione is Cc1ccc(Oc2ccc(Cn3ccc(=O)n(C(F)F)c3=O)cc2Cl)c(C)c1.
What is the InChIKey of 1-[[3-chloro-4-(2,4-dimethylphenoxy)phenyl]methyl]-3-(difluoromethyl)pyrimidine-2,4-dione?
The InChIKey is IKHOWEAMRPXBNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClF2N2O3/c1-12-3-5-16(13(2)9-12)28-17-6-4-14(10-15(17)21)11-24-8-7-18(26)25(19(22)23)20(24)27/h3-10,19H,11H2,1-2H3.
What are the key properties of 1-[[3-chloro-4-(2,4-dimethylphenoxy)phenyl]methyl]-3-(difluoromethyl)pyrimidine-2,4-dione?
1-[[3-chloro-4-(2,4-dimethylphenoxy)phenyl]methyl]-3-(difluoromethyl)pyrimidine-2,4-dione has a molecular weight of 406.82 g/mol, XLogP of 4.52, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3-chloro-4-(2,4-dimethylphenoxy)phenyl]methyl]-3-(difluoromethyl)pyrimidine-2,4-dione is sourced from PubChem (CID 167252096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).