C16H8Cl2F3N3O3 — CID 167252420
2-[[2,6-dichloro-4-(3,4,5-trifluorophenoxy)phenyl]methyl]-1,2,4-triazine-3,5-dione (PubChem CID 167252420) has the molecular formula C16H8Cl2F3N3O3 and a molecular weight of 418.16 g/mol. Its IUPAC name is 2-[[2,6-dichloro-4-(3,4,5-trifluorophenoxy)phenyl]methyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[[2,6-dichloro-4-(3,4,5-trifluorophenoxy)phenyl]methyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 167252420 |
| Molecular Formula | C16H8Cl2F3N3O3 |
| Molecular Weight | 418.16 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | 2-[[2,6-dichloro-4-(3,4,5-trifluorophenoxy)phenyl]methyl]-1,2,4-triazine-3,5-dione |
| SMILES | O=c1cnn(Cc2c(Cl)cc(Oc3cc(F)c(F)c(F)c3)cc2Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C16H8Cl2F3N3O3/c17-10-1-7(27-8-3-12(19)15(21)13(20)4-8)2-11(18)9(10)6-24-16(26)23-14(25)5-22-24/h1-5H,6H2,(H,23,25,26) |
| InChIKey | UIBXOGUZACHFEI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.16 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|