C12H23N — CID 167252807
1-[(3S)-3-bicyclo[4.2.0]octanyl]-2-methylpropan-2-amine (PubChem CID 167252807) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 1-[(3S)-3-bicyclo[4.2.0]octanyl]-2-methylpropan-2-amine.
| Compound Name | 1-[(3S)-3-bicyclo[4.2.0]octanyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 167252807 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 1-[(3S)-3-bicyclo[4.2.0]octanyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(N)C[C@H]1CCC2CCC2C1 |
| InChI | InChI=1S/C12H23N/c1-12(2,13)8-9-3-4-10-5-6-11(10)7-9/h9-11H,3-8,13H2,1-2H3/t9-,10?,11?/m0/s1 |
| InChIKey | IILPSNYXNUMNOV-WHXUTIOJSA-N |
| XLogP | 2.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |