C11H8N4O4 — CID 167253598
1-(2-oxo-[1,3]oxazolo[4,5-d]pyrimidin-3-yl)-3-azabicyclo[3.1.1]heptane-2,4-dione (PubChem CID 167253598) has the molecular formula C11H8N4O4 and a molecular weight of 260.21 g/mol. Its IUPAC name is 1-(2-oxo-[1,3]oxazolo[4,5-d]pyrimidin-3-yl)-3-azabicyclo[3.1.1]heptane-2,4-dione.
| Compound Name | 1-(2-oxo-[1,3]oxazolo[4,5-d]pyrimidin-3-yl)-3-azabicyclo[3.1.1]heptane-2,4-dione |
|---|---|
| PubChem CID | 167253598 |
| Molecular Formula | C11H8N4O4 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 1-(2-oxo-[1,3]oxazolo[4,5-d]pyrimidin-3-yl)-3-azabicyclo[3.1.1]heptane-2,4-dione |
| SMILES | O=C1NC(=O)C2(n3c(=O)oc4cncnc43)CC1C2 |
| InChI | InChI=1S/C11H8N4O4/c16-8-5-1-11(2-5,9(17)14-8)15-7-6(19-10(15)18)3-12-4-13-7/h3-5H,1-2H2,(H,14,16,17) |
| InChIKey | IWCKMBXJMIJDMT-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|