C15H22N2 — CID 167254275
4-(3,4-dihydropyridin-5-yl)-1-ethyl-2,3,3a,6,7,7a-hexahydroindole (PubChem CID 167254275) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 4-(3,4-dihydropyridin-5-yl)-1-ethyl-2,3,3a,6,7,7a-hexahydroindole.
| Compound Name | 4-(3,4-dihydropyridin-5-yl)-1-ethyl-2,3,3a,6,7,7a-hexahydroindole |
|---|---|
| PubChem CID | 167254275 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 4-(3,4-dihydropyridin-5-yl)-1-ethyl-2,3,3a,6,7,7a-hexahydroindole |
| SMILES | CCN1CCC2C(C3=CN=CCC3)=CCCC21 |
| InChI | InChI=1S/C15H22N2/c1-2-17-10-8-14-13(6-3-7-15(14)17)12-5-4-9-16-11-12/h6,9,11,14-15H,2-5,7-8,10H2,1H3 |
| InChIKey | VWUDGVWJDQDBFJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |