About 2,6-dimethyl-4-phenyl-2,3-dihydropyridine
2,6-dimethyl-4-phenyl-2,3-dihydropyridine (PubChem CID 167254517) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is 2,6-dimethyl-4-phenyl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 2,6-dimethyl-4-phenyl-2,3-dihydropyridine |
| PubChem CID | 167254517 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 2,6-dimethyl-4-phenyl-2,3-dihydropyridine |
| SMILES | CC1=NC(C)CC(c2ccccc2)=C1 |
| InChI | InChI=1S/C13H15N/c1-10-8-13(9-11(2)14-10)12-6-4-3-5-7-12/h3-8,11H,9H2,1-2H3 |
| InChIKey | DEMGPBKMDHZSGT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-dimethyl-4-phenyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-4-phenyl-2,3-dihydropyridine?
The IUPAC name of 2,6-dimethyl-4-phenyl-2,3-dihydropyridine (CID 167254517) is 2,6-dimethyl-4-phenyl-2,3-dihydropyridine.
What is the SMILES notation for 2,6-dimethyl-4-phenyl-2,3-dihydropyridine?
The canonical SMILES for 2,6-dimethyl-4-phenyl-2,3-dihydropyridine is CC1=NC(C)CC(c2ccccc2)=C1.
What is the InChIKey of 2,6-dimethyl-4-phenyl-2,3-dihydropyridine?
The InChIKey is DEMGPBKMDHZSGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N/c1-10-8-13(9-11(2)14-10)12-6-4-3-5-7-12/h3-8,11H,9H2,1-2H3.
What are the key properties of 2,6-dimethyl-4-phenyl-2,3-dihydropyridine?
2,6-dimethyl-4-phenyl-2,3-dihydropyridine has a molecular weight of 185.27 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4-phenyl-2,3-dihydropyridine is sourced from PubChem (CID 167254517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).