About 3-methyl-6-propan-2-yl-1,3-oxazinan-2-one
3-methyl-6-propan-2-yl-1,3-oxazinan-2-one (PubChem CID 167255146) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is 3-methyl-6-propan-2-yl-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | 3-methyl-6-propan-2-yl-1,3-oxazinan-2-one |
| PubChem CID | 167255146 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 3-methyl-6-propan-2-yl-1,3-oxazinan-2-one |
| SMILES | CC(C)C1CCN(C)C(=O)O1 |
| InChI | InChI=1S/C8H15NO2/c1-6(2)7-4-5-9(3)8(10)11-7/h6-7H,4-5H2,1-3H3 |
| InChIKey | PIZNKUWAXHOFGJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-6-propan-2-yl-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-propan-2-yl-1,3-oxazinan-2-one?
The IUPAC name of 3-methyl-6-propan-2-yl-1,3-oxazinan-2-one (CID 167255146) is 3-methyl-6-propan-2-yl-1,3-oxazinan-2-one.
What is the SMILES notation for 3-methyl-6-propan-2-yl-1,3-oxazinan-2-one?
The canonical SMILES for 3-methyl-6-propan-2-yl-1,3-oxazinan-2-one is CC(C)C1CCN(C)C(=O)O1.
What is the InChIKey of 3-methyl-6-propan-2-yl-1,3-oxazinan-2-one?
The InChIKey is PIZNKUWAXHOFGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-6(2)7-4-5-9(3)8(10)11-7/h6-7H,4-5H2,1-3H3.
What are the key properties of 3-methyl-6-propan-2-yl-1,3-oxazinan-2-one?
3-methyl-6-propan-2-yl-1,3-oxazinan-2-one has a molecular weight of 157.21 g/mol, XLogP of 1.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-propan-2-yl-1,3-oxazinan-2-one is sourced from PubChem (CID 167255146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).