C29H31F6N5O5 — CID 16725544
ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-hydroxyethoxy)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate (PubChem CID 16725544) has the molecular formula C29H31F6N5O5 and a molecular weight of 643.59 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-hydroxyethoxy)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-hydroxyethoxy)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 16725544 |
| Molecular Formula | C29H31F6N5O5 |
| Molecular Weight | 643.59 g/mol |
| Exact Mass | 643.22 |
| IUPAC Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-hydroxyethoxy)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccc(OC)nc2[C@@H](Nc2ncc(OCCO)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C[C@H]1CC |
| InChI | InChI=1S/C29H31F6N5O5/c1-4-19-14-21(25-22(6-7-24(39-25)43-3)40(19)27(42)44-5-2)38-26-36-15-23(45-9-8-41)20(37-26)12-16-10-17(28(30,31)32)13-18(11-16)29(33,34)35/h6-7,10-11,13,15,19,21,41H,4-5,8-9,12,14H2,1-3H3,(H,36,37,38)/t19-,21+/m1/s1 |
| InChIKey | GSGMEUVUGNHHPG-CTNGQTDRSA-N |
| XLogP | 6.18 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.59 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |