About 4-ethyl-1,1,1-trifluoro-N-methyl-3-(trifluoromethyl)hex-3-en-2-imine
4-ethyl-1,1,1-trifluoro-N-methyl-3-(trifluoromethyl)hex-3-en-2-imine (PubChem CID 167255590) has the molecular formula C10H13F6N
and a molecular weight of 261.21 g/mol. Its IUPAC name is 4-ethyl-1,1,1-trifluoro-N-methyl-3-(trifluoromethyl)hex-3-en-2-imine.
Molecular Properties
| Compound Name | 4-ethyl-1,1,1-trifluoro-N-methyl-3-(trifluoromethyl)hex-3-en-2-imine |
| PubChem CID | 167255590 |
| Molecular Formula | C10H13F6N |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-ethyl-1,1,1-trifluoro-N-methyl-3-(trifluoromethyl)hex-3-en-2-imine |
| SMILES | CCC(CC)=C(/C(=N/C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H13F6N/c1-4-6(5-2)7(9(11,12)13)8(17-3)10(14,15)16/h4-5H2,1-3H3/b17-8- |
| InChIKey | BACFLFXSKACEOD-IUXPMGMMSA-N |
| XLogP | 4.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-1,1,1-trifluoro-N-methyl-3-(trifluoromethyl)hex-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,1,1-trifluoro-N-methyl-3-(trifluoromethyl)hex-3-en-2-imine?
The IUPAC name of 4-ethyl-1,1,1-trifluoro-N-methyl-3-(trifluoromethyl)hex-3-en-2-imine (CID 167255590) is 4-ethyl-1,1,1-trifluoro-N-methyl-3-(trifluoromethyl)hex-3-en-2-imine.
What is the SMILES notation for 4-ethyl-1,1,1-trifluoro-N-methyl-3-(trifluoromethyl)hex-3-en-2-imine?
The canonical SMILES for 4-ethyl-1,1,1-trifluoro-N-methyl-3-(trifluoromethyl)hex-3-en-2-imine is CCC(CC)=C(/C(=N/C)C(F)(F)F)C(F)(F)F.
What is the InChIKey of 4-ethyl-1,1,1-trifluoro-N-methyl-3-(trifluoromethyl)hex-3-en-2-imine?
The InChIKey is BACFLFXSKACEOD-IUXPMGMMSA-N. The full InChI is InChI=1S/C10H13F6N/c1-4-6(5-2)7(9(11,12)13)8(17-3)10(14,15)16/h4-5H2,1-3H3/b17-8-.
What are the key properties of 4-ethyl-1,1,1-trifluoro-N-methyl-3-(trifluoromethyl)hex-3-en-2-imine?
4-ethyl-1,1,1-trifluoro-N-methyl-3-(trifluoromethyl)hex-3-en-2-imine has a molecular weight of 261.21 g/mol, XLogP of 4.30, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,1,1-trifluoro-N-methyl-3-(trifluoromethyl)hex-3-en-2-imine is sourced from PubChem (CID 167255590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).