C30H33F6N5O6 — CID 16725575
ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2,3-dihydroxypropoxy)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate (PubChem CID 16725575) has the molecular formula C30H33F6N5O6 and a molecular weight of 673.61 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2,3-dihydroxypropoxy)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2,3-dihydroxypropoxy)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 16725575 |
| Molecular Formula | C30H33F6N5O6 |
| Molecular Weight | 673.61 g/mol |
| Exact Mass | 673.23 |
| IUPAC Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2,3-dihydroxypropoxy)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccc(OC)nc2[C@@H](Nc2ncc(OCC(O)CO)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C[C@H]1CC |
| InChI | InChI=1S/C30H33F6N5O6/c1-4-19-12-22(26-23(6-7-25(40-26)45-3)41(19)28(44)46-5-2)39-27-37-13-24(47-15-20(43)14-42)21(38-27)10-16-8-17(29(31,32)33)11-18(9-16)30(34,35)36/h6-9,11,13,19-20,22,42-43H,4-5,10,12,14-15H2,1-3H3,(H,37,38,39)/t19-,20?,22+/m1/s1 |
| InChIKey | ZDCOZYMIVNBQJJ-OBIJOXKXSA-N |
| XLogP | 5.54 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |